C27H40O5Si — CID 134972367
[(2S,3S)-3-[(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethoxy)-3-methylpentyl]oxiran-2-yl]methanol (PubChem CID 134972367) has the molecular formula C27H40O5Si and a molecular weight of 472.70 g/mol. Its IUPAC name is [(2S,3S)-3-[(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethoxy)-3-methylpentyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethoxy)-3-methylpentyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 134972367 |
| Molecular Formula | C27H40O5Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [(2S,3S)-3-[(2R,3S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethoxy)-3-methylpentyl]oxiran-2-yl]methanol |
| SMILES | COCO[C@H](C[C@@H]1O[C@H]1CO)[C@@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O5Si/c1-21(24(30-20-29-5)18-25-26(19-28)32-25)16-17-31-33(27(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,21,24-26,28H,16-20H2,1-5H3/t21-,24+,25-,26-/m0/s1 |
| InChIKey | ZPAQHJUOJTUJBC-QUKDMSEQSA-N |
| XLogP | 3.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|