C26H47N5O8 — CID 134972423
tritert-butyl 14,16-dioxo-1,4,7,10,13-pentazacyclohexadecane-4,7,10-tricarboxylate (PubChem CID 134972423) has the molecular formula C26H47N5O8 and a molecular weight of 557.69 g/mol. Its IUPAC name is tritert-butyl 14,16-dioxo-1,4,7,10,13-pentazacyclohexadecane-4,7,10-tricarboxylate.
| Compound Name | tritert-butyl 14,16-dioxo-1,4,7,10,13-pentazacyclohexadecane-4,7,10-tricarboxylate |
|---|---|
| PubChem CID | 134972423 |
| Molecular Formula | C26H47N5O8 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | tritert-butyl 14,16-dioxo-1,4,7,10,13-pentazacyclohexadecane-4,7,10-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(=O)CC(=O)NCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H47N5O8/c1-24(2,3)37-21(34)29-12-10-27-19(32)18-20(33)28-11-13-30(22(35)38-25(4,5)6)15-17-31(16-14-29)23(36)39-26(7,8)9/h10-18H2,1-9H3,(H,27,32)(H,28,33) |
| InChIKey | CQJZWJVFQULBPD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|