C42H46INO4Si — CID 134972446
(2S,3S,4S)-N-[tert-butyl(diphenyl)silyl]oxy-4-iodo-2,3,5-tris(phenylmethoxy)pentan-1-imine (PubChem CID 134972446) has the molecular formula C42H46INO4Si and a molecular weight of 783.82 g/mol. Its IUPAC name is (2S,3S,4S)-N-[tert-butyl(diphenyl)silyl]oxy-4-iodo-2,3,5-tris(phenylmethoxy)pentan-1-imine.
| Compound Name | (2S,3S,4S)-N-[tert-butyl(diphenyl)silyl]oxy-4-iodo-2,3,5-tris(phenylmethoxy)pentan-1-imine |
|---|---|
| PubChem CID | 134972446 |
| Molecular Formula | C42H46INO4Si |
| Molecular Weight | 783.82 g/mol |
| Exact Mass | 783.22 |
| IUPAC Name | (2S,3S,4S)-N-[tert-butyl(diphenyl)silyl]oxy-4-iodo-2,3,5-tris(phenylmethoxy)pentan-1-imine |
| SMILES | CC(C)(C)[Si](ON=C[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](I)COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H46INO4Si/c1-42(2,3)49(37-25-15-7-16-26-37,38-27-17-8-18-28-38)48-44-29-40(46-31-35-21-11-5-12-22-35)41(47-32-36-23-13-6-14-24-36)39(43)33-45-30-34-19-9-4-10-20-34/h4-29,39-41H,30-33H2,1-3H3/t39-,40-,41+/m0/s1 |
| InChIKey | ZHQWCBPDKZQUHF-YZBUDRBASA-N |
| XLogP | 8.74 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.82 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|