C38H47NO8SSi — CID 134972492
[(2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxyimino-4-(methoxymethoxy)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 134972492) has the molecular formula C38H47NO8SSi and a molecular weight of 705.95 g/mol. Its IUPAC name is [(2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxyimino-4-(methoxymethoxy)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate.
| Compound Name | [(2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxyimino-4-(methoxymethoxy)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 134972492 |
| Molecular Formula | C38H47NO8SSi |
| Molecular Weight | 705.95 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | [(2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxyimino-4-(methoxymethoxy)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | COCO[C@H](C=NO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C38H47NO8SSi/c1-38(2,3)49(33-22-14-8-15-23-33,34-24-16-9-17-25-34)47-39-26-35(45-30-42-4)37(44-28-32-20-12-7-13-21-32)36(46-48(5,40)41)29-43-27-31-18-10-6-11-19-31/h6-26,35-37H,27-30H2,1-5H3/t35-,36+,37+/m1/s1 |
| InChIKey | HVLLUZIMLOTONH-BOALQFNTSA-N |
| XLogP | 5.68 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|