C26H22NO6P — CID 134972541
1-dimethoxyphosphoryl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 134972541) has the molecular formula C26H22NO6P and a molecular weight of 475.44 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | 1-dimethoxyphosphoryl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 134972541 |
| Molecular Formula | C26H22NO6P |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-dimethoxyphosphoryl-8,11-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | COP(=O)(OC)C12OC(c3ccccc3)(c3ccccc31)C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C26H22NO6P/c1-31-34(30,32-2)26-20-16-10-9-15-19(20)25(33-26,17-11-5-3-6-12-17)21-22(26)24(29)27(23(21)28)18-13-7-4-8-14-18/h3-16,21-22H,1-2H3 |
| InChIKey | CGDCCPGGQXWRTD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|