C18H33O3+ — CID 134972573
[1-hydroxy-2-[(6R)-3-(1-hydroxy-2-methylheptan-2-yl)-1,6-dimethylcyclohex-2-en-1-yl]ethylidene]oxidanium (PubChem CID 134972573) has the molecular formula C18H33O3+ and a molecular weight of 297.46 g/mol. Its IUPAC name is [1-hydroxy-2-[(6R)-3-(1-hydroxy-2-methylheptan-2-yl)-1,6-dimethylcyclohex-2-en-1-yl]ethylidene]oxidanium.
| Compound Name | [1-hydroxy-2-[(6R)-3-(1-hydroxy-2-methylheptan-2-yl)-1,6-dimethylcyclohex-2-en-1-yl]ethylidene]oxidanium |
|---|---|
| PubChem CID | 134972573 |
| Molecular Formula | C18H33O3+ |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | [1-hydroxy-2-[(6R)-3-(1-hydroxy-2-methylheptan-2-yl)-1,6-dimethylcyclohex-2-en-1-yl]ethylidene]oxidanium |
| SMILES | [H]/[O+]=C(\O)CC1(C)C=C(C(C)(CO)CCCCC)CC[C@H]1C |
| InChI | InChI=1S/C18H32O3/c1-5-6-7-10-17(3,13-19)15-9-8-14(2)18(4,11-15)12-16(20)21/h11,14,19H,5-10,12-13H2,1-4H3,(H,20,21)/p+1/t14-,17?,18?/m1/s1 |
| InChIKey | QFOHKTKNODLJHF-RWBZWWBESA-O |
| XLogP | 4.38 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|