C18H30O3 — CID 134972836
[(1S,5S)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl acetate (PubChem CID 134972836) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is [(1S,5S)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,5S)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 134972836 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | [(1S,5S)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CCCC2=C1CCC(C)[C@]2(C)CCO |
| InChI | InChI=1S/C18H30O3/c1-13-7-8-15-16(18(13,4)10-11-19)6-5-9-17(15,3)12-21-14(2)20/h13,19H,5-12H2,1-4H3/t13?,17-,18+/m1/s1 |
| InChIKey | WSSGUMXTJPOEDF-YMSDKTMASA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|