C17H28O3 — CID 134972846
methyl (1S,5S,8aS)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 134972846) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl (1S,5S,8aS)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,5S,8aS)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134972846 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | methyl (1S,5S,8aS)-5-(2-hydroxyethyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC=C2[C@@H]1CCC(C)[C@]2(C)CCO |
| InChI | InChI=1S/C17H28O3/c1-12-7-8-14-13(16(12,2)10-11-18)6-5-9-17(14,3)15(19)20-4/h6,12,14,18H,5,7-11H2,1-4H3/t12?,14-,16-,17-/m0/s1 |
| InChIKey | PHEDBILKQPSREI-FTXSGDFPSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|