C26H15OS2- — CID 134972904
7-(2-cyclopenta-1,3-dien-1-ylethynyl)-2-[2-(4-methoxyphenyl)ethynyl]thieno[3,2-e][1]benzothiole (PubChem CID 134972904) has the molecular formula C26H15OS2- and a molecular weight of 407.54 g/mol. Its IUPAC name is 7-(2-cyclopenta-1,3-dien-1-ylethynyl)-2-[2-(4-methoxyphenyl)ethynyl]thieno[3,2-e][1]benzothiole.
| Compound Name | 7-(2-cyclopenta-1,3-dien-1-ylethynyl)-2-[2-(4-methoxyphenyl)ethynyl]thieno[3,2-e][1]benzothiole |
|---|---|
| PubChem CID | 134972904 |
| Molecular Formula | C26H15OS2- |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 7-(2-cyclopenta-1,3-dien-1-ylethynyl)-2-[2-(4-methoxyphenyl)ethynyl]thieno[3,2-e][1]benzothiole |
| SMILES | COc1ccc(C#Cc2cc3c(ccc4sc(C#Cc5ccc[cH-]5)cc43)s2)cc1 |
| InChI | InChI=1S/C26H15OS2/c1-27-20-10-6-19(7-11-20)9-13-22-17-24-23-16-21(12-8-18-4-2-3-5-18)28-25(23)14-15-26(24)29-22/h2-7,10-11,14-17H,1H3/q-1 |
| InChIKey | XHIBYZXKWLALIY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|