About 1,2-diethyl-3-methoxy-1,4-dimethylindene
1,2-diethyl-3-methoxy-1,4-dimethylindene (PubChem CID 134972913) has the molecular formula C16H22O
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1,2-diethyl-3-methoxy-1,4-dimethylindene.
Molecular Properties
| Compound Name | 1,2-diethyl-3-methoxy-1,4-dimethylindene |
| PubChem CID | 134972913 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1,2-diethyl-3-methoxy-1,4-dimethylindene |
| SMILES | CCC1=C(OC)c2c(C)cccc2C1(C)CC |
| InChI | InChI=1S/C16H22O/c1-6-12-15(17-5)14-11(3)9-8-10-13(14)16(12,4)7-2/h8-10H,6-7H2,1-5H3 |
| InChIKey | ZWRXRNBSJSWDCK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-diethyl-3-methoxy-1,4-dimethylindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-3-methoxy-1,4-dimethylindene?
The IUPAC name of 1,2-diethyl-3-methoxy-1,4-dimethylindene (CID 134972913) is 1,2-diethyl-3-methoxy-1,4-dimethylindene.
What is the SMILES notation for 1,2-diethyl-3-methoxy-1,4-dimethylindene?
The canonical SMILES for 1,2-diethyl-3-methoxy-1,4-dimethylindene is CCC1=C(OC)c2c(C)cccc2C1(C)CC.
What is the InChIKey of 1,2-diethyl-3-methoxy-1,4-dimethylindene?
The InChIKey is ZWRXRNBSJSWDCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O/c1-6-12-15(17-5)14-11(3)9-8-10-13(14)16(12,4)7-2/h8-10H,6-7H2,1-5H3.
What are the key properties of 1,2-diethyl-3-methoxy-1,4-dimethylindene?
1,2-diethyl-3-methoxy-1,4-dimethylindene has a molecular weight of 230.35 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-3-methoxy-1,4-dimethylindene is sourced from PubChem (CID 134972913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).