C39H45NO8 — CID 134972946
[(2R,3R,5S,6R)-3-acetamido-1-hydroxy-2,5,6,7-tetrakis(phenylmethoxy)heptan-4-yl] acetate (PubChem CID 134972946) has the molecular formula C39H45NO8 and a molecular weight of 655.79 g/mol. Its IUPAC name is [(2R,3R,5S,6R)-3-acetamido-1-hydroxy-2,5,6,7-tetrakis(phenylmethoxy)heptan-4-yl] acetate.
| Compound Name | [(2R,3R,5S,6R)-3-acetamido-1-hydroxy-2,5,6,7-tetrakis(phenylmethoxy)heptan-4-yl] acetate |
|---|---|
| PubChem CID | 134972946 |
| Molecular Formula | C39H45NO8 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.31 |
| IUPAC Name | [(2R,3R,5S,6R)-3-acetamido-1-hydroxy-2,5,6,7-tetrakis(phenylmethoxy)heptan-4-yl] acetate |
| SMILES | CC(=O)N[C@@H](C(OC(C)=O)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1)[C@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C39H45NO8/c1-29(42)40-37(35(23-41)45-25-32-17-9-4-10-18-32)39(48-30(2)43)38(47-27-34-21-13-6-14-22-34)36(46-26-33-19-11-5-12-20-33)28-44-24-31-15-7-3-8-16-31/h3-22,35-39,41H,23-28H2,1-2H3,(H,40,42)/t35-,36+,37+,38+,39?/m0/s1 |
| InChIKey | FRVSYFUYWCLRGO-CZHXOIKLSA-N |
| XLogP | 5.39 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |