C17H32O5Si — CID 134973048
tert-butyl-[(3E)-4-[5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]buta-1,3-dien-2-yl]oxy-dimethylsilane (PubChem CID 134973048) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is tert-butyl-[(3E)-4-[5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]buta-1,3-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3E)-4-[5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]buta-1,3-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134973048 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | tert-butyl-[(3E)-4-[5-(methoxymethoxy)-2-methyl-1,3-dioxan-4-yl]buta-1,3-dien-2-yl]oxy-dimethylsilane |
| SMILES | C=C(/C=C/C1OC(C)OCC1OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O5Si/c1-13(22-23(7,8)17(3,4)5)9-10-15-16(20-12-18-6)11-19-14(2)21-15/h9-10,14-16H,1,11-12H2,2-8H3/b10-9+ |
| InChIKey | RTZWMJAJOGEYJD-MDZDMXLPSA-N |
| XLogP | 3.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|