C16H24O9 — CID 134973074
3,4-dihydroxy-6-[(2R,6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxan-2-one (PubChem CID 134973074) has the molecular formula C16H24O9 and a molecular weight of 360.36 g/mol. Its IUPAC name is 3,4-dihydroxy-6-[(2R,6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxan-2-one.
| Compound Name | 3,4-dihydroxy-6-[(2R,6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxan-2-one |
|---|---|
| PubChem CID | 134973074 |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 3,4-dihydroxy-6-[(2R,6R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxan-2-one |
| SMILES | CC1(C)OC2C(C3CC(O)C(O)C(=O)O3)O[C@@H]3OC(C)(C)O[C@@H]3C2O1 |
| InChI | InChI=1S/C16H24O9/c1-15(2)22-10-9(7-5-6(17)8(18)13(19)20-7)21-14-12(11(10)23-15)24-16(3,4)25-14/h6-12,14,17-18H,5H2,1-4H3/t6?,7?,8?,9?,10?,11?,12-,14-/m1/s1 |
| InChIKey | MLYDNHOLLUOTLE-YKTQODENSA-N |
| XLogP | -0.58 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |