C18H28O8 — CID 134973117
ethyl (Z,5R)-5-hydroxy-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pent-2-enoate (PubChem CID 134973117) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is ethyl (Z,5R)-5-hydroxy-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pent-2-enoate.
| Compound Name | ethyl (Z,5R)-5-hydroxy-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pent-2-enoate |
|---|---|
| PubChem CID | 134973117 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | ethyl (Z,5R)-5-hydroxy-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C\C[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H28O8/c1-6-21-11(20)9-7-8-10(19)12-13-14(24-17(2,3)23-13)15-16(22-12)26-18(4,5)25-15/h7,9-10,12-16,19H,6,8H2,1-5H3/b9-7-/t10-,12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | QDUMDYODNZDUTN-FUCYLTSUSA-N |
| XLogP | 1.25 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|