C8H9NO5 — CID 134973148
methyl (Z)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)but-2-enoate (PubChem CID 134973148) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is methyl (Z)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)but-2-enoate.
| Compound Name | methyl (Z)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)but-2-enoate |
|---|---|
| PubChem CID | 134973148 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | methyl (Z)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)but-2-enoate |
| SMILES | COC(=O)/C=C\C(=O)N1CCOC1=O |
| InChI | InChI=1S/C8H9NO5/c1-13-7(11)3-2-6(10)9-4-5-14-8(9)12/h2-3H,4-5H2,1H3/b3-2- |
| InChIKey | RGOXHVMJDFBAOV-IHWYPQMZSA-N |
| XLogP | -0.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|