C18H17NO2 — CID 134973204
(8R,9R)-7-methyl-3-oxa-7-azapentacyclo[7.6.2.25,8.01,5.010,15]nonadeca-10,12,14,16,18-pentaen-6-one (PubChem CID 134973204) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (8R,9R)-7-methyl-3-oxa-7-azapentacyclo[7.6.2.25,8.01,5.010,15]nonadeca-10,12,14,16,18-pentaen-6-one.
| Compound Name | (8R,9R)-7-methyl-3-oxa-7-azapentacyclo[7.6.2.25,8.01,5.010,15]nonadeca-10,12,14,16,18-pentaen-6-one |
|---|---|
| PubChem CID | 134973204 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (8R,9R)-7-methyl-3-oxa-7-azapentacyclo[7.6.2.25,8.01,5.010,15]nonadeca-10,12,14,16,18-pentaen-6-one |
| SMILES | CN1C(=O)C23C=C[C@@H]1[C@@H]1C=CC2(COC3)c2ccccc21 |
| InChI | InChI=1S/C18H17NO2/c1-19-15-7-9-18(16(19)20)11-21-10-17(18)8-6-13(15)12-4-2-3-5-14(12)17/h2-9,13,15H,10-11H2,1H3/t13-,15-,17?,18?/m1/s1 |
| InChIKey | PULGESUWCRNKBR-ISMHFCACSA-N |
| XLogP | 2.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|