About spiro[benzo[c]chromene-6,2'-pyran]
spiro[benzo[c]chromene-6,2'-pyran] (PubChem CID 134973282) has the molecular formula C17H12O2
and a molecular weight of 248.28 g/mol. Its IUPAC name is spiro[benzo[c]chromene-6,2'-pyran].
Molecular Properties
| Compound Name | spiro[benzo[c]chromene-6,2'-pyran] |
| PubChem CID | 134973282 |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | spiro[benzo[c]chromene-6,2'-pyran] |
| SMILES | C1=COC2(C=C1)Oc1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C17H12O2/c1-3-9-15-13(7-1)14-8-2-4-10-16(14)19-17(15)11-5-6-12-18-17/h1-12H |
| InChIKey | VASUTQZCXBHEOZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[benzo[c]chromene-6,2'-pyran] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[benzo[c]chromene-6,2'-pyran]?
The IUPAC name of spiro[benzo[c]chromene-6,2'-pyran] (CID 134973282) is spiro[benzo[c]chromene-6,2'-pyran].
What is the SMILES notation for spiro[benzo[c]chromene-6,2'-pyran]?
The canonical SMILES for spiro[benzo[c]chromene-6,2'-pyran] is C1=COC2(C=C1)Oc1ccccc1-c1ccccc12.
What is the InChIKey of spiro[benzo[c]chromene-6,2'-pyran]?
The InChIKey is VASUTQZCXBHEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O2/c1-3-9-15-13(7-1)14-8-2-4-10-16(14)19-17(15)11-5-6-12-18-17/h1-12H.
What are the key properties of spiro[benzo[c]chromene-6,2'-pyran]?
spiro[benzo[c]chromene-6,2'-pyran] has a molecular weight of 248.28 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[benzo[c]chromene-6,2'-pyran] is sourced from PubChem (CID 134973282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).