C11H21N2O8+ — CID 134973299
[(2S,4R,5R)-5-acetamido-2-carboxy-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-4-yl]azanium (PubChem CID 134973299) has the molecular formula C11H21N2O8+ and a molecular weight of 309.30 g/mol. Its IUPAC name is [(2S,4R,5R)-5-acetamido-2-carboxy-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-4-yl]azanium.
| Compound Name | [(2S,4R,5R)-5-acetamido-2-carboxy-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-4-yl]azanium |
|---|---|
| PubChem CID | 134973299 |
| Molecular Formula | C11H21N2O8+ |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [(2S,4R,5R)-5-acetamido-2-carboxy-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-4-yl]azanium |
| SMILES | CC(=O)N[C@H]1C([C@H](O)[C@H](O)CO)O[C@](O)(C(=O)O)C[C@H]1[NH3+] |
| InChI | InChI=1S/C11H20N2O8/c1-4(15)13-7-5(12)2-11(20,10(18)19)21-9(7)8(17)6(16)3-14/h5-9,14,16-17,20H,2-3,12H2,1H3,(H,13,15)(H,18,19)/p+1/t5-,6-,7-,8-,9?,11+/m1/s1 |
| InChIKey | HTKPUQJKBISZFY-VZTAULPXSA-O |
| XLogP | -4.62 |
| TPSA | 184.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |