C23H32Br4O4 — CID 134973323
methyl (2E,3S)-2-[bromo-[(1S,2R,3R,4R)-2,3,8-tribromo-2,3-dimethyl-6-oxo-7-[(2R)-pentan-2-yl]-5-oxaspiro[3.4]oct-7-en-1-yl]methylidene]-3-methylhexanoate (PubChem CID 134973323) has the molecular formula C23H32Br4O4 and a molecular weight of 692.12 g/mol. Its IUPAC name is methyl (2E,3S)-2-[bromo-[(1S,2R,3R,4R)-2,3,8-tribromo-2,3-dimethyl-6-oxo-7-[(2R)-pentan-2-yl]-5-oxaspiro[3.4]oct-7-en-1-yl]methylidene]-3-methylhexanoate.
| Compound Name | methyl (2E,3S)-2-[bromo-[(1S,2R,3R,4R)-2,3,8-tribromo-2,3-dimethyl-6-oxo-7-[(2R)-pentan-2-yl]-5-oxaspiro[3.4]oct-7-en-1-yl]methylidene]-3-methylhexanoate |
|---|---|
| PubChem CID | 134973323 |
| Molecular Formula | C23H32Br4O4 |
| Molecular Weight | 692.12 g/mol |
| Exact Mass | 687.90 |
| IUPAC Name | methyl (2E,3S)-2-[bromo-[(1S,2R,3R,4R)-2,3,8-tribromo-2,3-dimethyl-6-oxo-7-[(2R)-pentan-2-yl]-5-oxaspiro[3.4]oct-7-en-1-yl]methylidene]-3-methylhexanoate |
| SMILES | CCC[C@@H](C)C1=C(Br)[C@]2(OC1=O)[C@@H](/C(Br)=C(\C(=O)OC)[C@@H](C)CCC)[C@@](C)(Br)[C@]2(C)Br |
| InChI | InChI=1S/C23H32Br4O4/c1-8-10-12(3)14(19(28)30-7)16(24)17-21(5,26)22(6,27)23(17)18(25)15(20(29)31-23)13(4)11-9-2/h12-13,17H,8-11H2,1-7H3/b16-14+/t12-,13+,17-,21+,22-,23+/m0/s1 |
| InChIKey | NKEQQDLGCAOFRV-JEXGDEOCSA-N |
| XLogP | 7.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.12 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|