About 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide
2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide (PubChem CID 13497333) has the molecular formula C10H8Cl2N2OS
and a molecular weight of 275.16 g/mol. Its IUPAC name is 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide |
| PubChem CID | 13497333 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide |
| SMILES | Cc1ccc2nsc(NC(=O)C(Cl)Cl)c2c1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c1-5-2-3-7-6(4-5)10(16-14-7)13-9(15)8(11)12/h2-4,8H,1H3,(H,13,15) |
| InChIKey | JQWVLIFRBKHDNM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide?
The IUPAC name of 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide (CID 13497333) is 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide.
What is the SMILES notation for 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide?
The canonical SMILES for 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide is Cc1ccc2nsc(NC(=O)C(Cl)Cl)c2c1.
What is the InChIKey of 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide?
The InChIKey is JQWVLIFRBKHDNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N2OS/c1-5-2-3-7-6(4-5)10(16-14-7)13-9(15)8(11)12/h2-4,8H,1H3,(H,13,15).
What are the key properties of 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide?
2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide has a molecular weight of 275.16 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide is sourced from PubChem (CID 13497333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).