C26H38O4Si — CID 134973355
(2R)-2-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 134973355) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is (2R)-2-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 134973355 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (2R)-2-[(4S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | C[C@H](CO)[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C26H38O4Si/c1-20(18-27)24-17-21(29-26(5,6)30-24)19-28-31(25(2,3)4,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,20-21,24,27H,17-19H2,1-6H3/t20-,21+,24+/m1/s1 |
| InChIKey | INJZNXVGUALCGO-DPLHUUCSSA-N |
| XLogP | 4.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|