C13H16INO6 — CID 134973391
N-butyl-2-[(1-hydroxy-1,3-dioxo-1λ5,2-benziodoxol-5-yl)oxy]acetamide (PubChem CID 134973391) has the molecular formula C13H16INO6 and a molecular weight of 409.18 g/mol. Its IUPAC name is N-butyl-2-[(1-hydroxy-1,3-dioxo-1λ5,2-benziodoxol-5-yl)oxy]acetamide.
| Compound Name | N-butyl-2-[(1-hydroxy-1,3-dioxo-1λ5,2-benziodoxol-5-yl)oxy]acetamide |
|---|---|
| PubChem CID | 134973391 |
| Molecular Formula | C13H16INO6 |
| Molecular Weight | 409.18 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | N-butyl-2-[(1-hydroxy-1,3-dioxo-1λ5,2-benziodoxol-5-yl)oxy]acetamide |
| SMILES | CCCCNC(=O)COc1ccc2c(c1)C(=O)OI2(=O)O |
| InChI | InChI=1S/C13H16INO6/c1-2-3-6-15-12(16)8-20-9-4-5-11-10(7-9)13(17)21-14(11,18)19/h4-5,7H,2-3,6,8H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | FJEAXAFUQFVHPH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|