C22H25NO7 — CID 134973409
(6R,8aS)-6-methoxy-7-(nitromethyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 134973409) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is (6R,8aS)-6-methoxy-7-(nitromethyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6R,8aS)-6-methoxy-7-(nitromethyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 134973409 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (6R,8aS)-6-methoxy-7-(nitromethyl)-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1OC2COC(c3ccccc3)O[C@H]2C(OCc2ccccc2)C1C[N+](=O)[O-] |
| InChI | InChI=1S/C22H25NO7/c1-26-22-17(12-23(24)25)19(27-13-15-8-4-2-5-9-15)20-18(29-22)14-28-21(30-20)16-10-6-3-7-11-16/h2-11,17-22H,12-14H2,1H3/t17?,18?,19?,20-,21?,22-/m1/s1 |
| InChIKey | ATULHPNHDBSZOS-BSQZXLNESA-N |
| XLogP | 2.95 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|