C34H38N2O17S — CID 134973440
[(3S,6S)-3,4,5-triacetyloxy-6-[(3R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(3,4-dicyanophenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 134973440) has the molecular formula C34H38N2O17S and a molecular weight of 778.74 g/mol. Its IUPAC name is [(3S,6S)-3,4,5-triacetyloxy-6-[(3R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(3,4-dicyanophenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-3,4,5-triacetyloxy-6-[(3R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(3,4-dicyanophenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134973440 |
| Molecular Formula | C34H38N2O17S |
| Molecular Weight | 778.74 g/mol |
| Exact Mass | 778.19 |
| IUPAC Name | [(3S,6S)-3,4,5-triacetyloxy-6-[(3R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-(3,4-dicyanophenyl)sulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Sc2ccc(C#N)c(C#N)c2)C(OC(C)=O)C(OC(C)=O)[C@@H]1O[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C34H38N2O17S/c1-15(37)44-13-25-27(46-17(3)39)29(47-18(4)40)31(49-20(6)42)33(51-25)53-28-26(14-45-16(2)38)52-34(32(50-21(7)43)30(28)48-19(5)41)54-24-9-8-22(11-35)23(10-24)12-36/h8-10,25-34H,13-14H2,1-7H3/t25?,26?,27-,28+,29?,30?,31?,32?,33-,34-/m0/s1 |
| InChIKey | PLUCEXIQEFVJJT-BLAAERJXSA-N |
| XLogP | 1.14 |
| TPSA | 259.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.74 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|