C23H30O13S — CID 134973445
[(3S,6R)-3,4,5-triacetyloxy-6-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-2-yl]methyl acetate (PubChem CID 134973445) has the molecular formula C23H30O13S and a molecular weight of 546.55 g/mol. Its IUPAC name is [(3S,6R)-3,4,5-triacetyloxy-6-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,6R)-3,4,5-triacetyloxy-6-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134973445 |
| Molecular Formula | C23H30O13S |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | [(3S,6R)-3,4,5-triacetyloxy-6-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OCCOS(=O)(=O)c2ccc(C)cc2)C(OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H30O13S/c1-13-6-8-18(9-7-13)37(28,29)32-11-10-30-23-22(35-17(5)27)21(34-16(4)26)20(33-15(3)25)19(36-23)12-31-14(2)24/h6-9,19-23H,10-12H2,1-5H3/t19?,20-,21?,22?,23+/m0/s1 |
| InChIKey | ZDAGAJVZPVFZLB-HCKIVHMLSA-N |
| XLogP | 0.80 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|