C33H60O9 — CID 134973460
(3S,6R)-3-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,5-dimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3S)-2,4,5,6-tetramethyloxan-3-yl]oxyoxan-4-yl]oxyoxan-4-ol (PubChem CID 134973460) has the molecular formula C33H60O9 and a molecular weight of 600.83 g/mol. Its IUPAC name is (3S,6R)-3-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,5-dimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3S)-2,4,5,6-tetramethyloxan-3-yl]oxyoxan-4-yl]oxyoxan-4-ol.
| Compound Name | (3S,6R)-3-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,5-dimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3S)-2,4,5,6-tetramethyloxan-3-yl]oxyoxan-4-yl]oxyoxan-4-ol |
|---|---|
| PubChem CID | 134973460 |
| Molecular Formula | C33H60O9 |
| Molecular Weight | 600.83 g/mol |
| Exact Mass | 600.42 |
| IUPAC Name | (3S,6R)-3-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,5-dimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3S)-2,4,5,6-tetramethyloxan-3-yl]oxyoxan-4-yl]oxyoxan-4-ol |
| SMILES | COC1C(C)[C@H](O[C@@H]2C(C)O[C@@H](OC3C(C)[C@H](O[C@@H]4C(C)OC(C)C(C)C4C)OC(C)[C@H]3C)C(C)C2O)OC(C)[C@H]1C |
| InChI | InChI=1S/C33H60O9/c1-14-15(2)29(24(11)36-21(14)8)41-33-20(7)28(17(4)23(10)38-33)40-31-18(5)26(34)30(25(12)39-31)42-32-19(6)27(35-13)16(3)22(9)37-32/h14-34H,1-13H3/t14?,15?,16-,17-,18?,19?,20?,21?,22?,23?,24?,25?,26?,27?,28?,29+,30-,31+,32+,33+/m1/s1 |
| InChIKey | MAALXIFQGUOFPQ-KHRLKATOSA-N |
| XLogP | 5.01 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |