C34H62O7 — CID 134973515
(3S,6S)-2,3,4,5-tetramethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxan-4-yl]oxyoxane (PubChem CID 134973515) has the molecular formula C34H62O7 and a molecular weight of 582.86 g/mol. Its IUPAC name is (3S,6S)-2,3,4,5-tetramethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxan-4-yl]oxyoxane.
| Compound Name | (3S,6S)-2,3,4,5-tetramethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxan-4-yl]oxyoxane |
|---|---|
| PubChem CID | 134973515 |
| Molecular Formula | C34H62O7 |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | (3S,6S)-2,3,4,5-tetramethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxan-4-yl]oxyoxane |
| SMILES | CC1C(C)[C@H](C)C(C)O[C@H]1OC1C(C)[C@H](OC2C(C)[C@H](OC3C(C)[C@H](C)OC(C)[C@H]3C)OC(C)[C@H]2C)OC(C)[C@H]1C |
| InChI | InChI=1S/C34H62O7/c1-15-16(2)24(10)36-32(17(15)3)40-30-20(6)27(13)38-34(22(30)8)41-31-21(7)28(14)37-33(23(31)9)39-29-18(4)25(11)35-26(12)19(29)5/h15-34H,1-14H3/t15?,16-,17?,18+,19?,20+,21+,22?,23?,24?,25?,26-,27?,28?,29?,30?,31?,32-,33-,34-/m0/s1 |
| InChIKey | ONWXJFNIKBACSB-LFNFKMFKSA-N |
| XLogP | 6.91 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |