About 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole
1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole (PubChem CID 134973585) has the molecular formula C36H36N3OP
and a molecular weight of 557.68 g/mol. Its IUPAC name is 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole |
| PubChem CID | 134973585 |
| Molecular Formula | C36H36N3OP |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1ccc(P(=O)(c2ccc(-n3c(C)ccc3C)cc2)c2ccc(-n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C36H36N3OP/c1-25-7-8-26(2)37(25)31-13-19-34(20-14-31)41(40,35-21-15-32(16-22-35)38-27(3)9-10-28(38)4)36-23-17-33(18-24-36)39-29(5)11-12-30(39)6/h7-24H,1-6H3 |
| InChIKey | XJGPCTFEGYRLGU-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 31.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole?
The IUPAC name of 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole (CID 134973585) is 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole.
What is the SMILES notation for 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole?
The canonical SMILES for 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole is Cc1ccc(C)n1-c1ccc(P(=O)(c2ccc(-n3c(C)ccc3C)cc2)c2ccc(-n3c(C)ccc3C)cc2)cc1.
What is the InChIKey of 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole?
The InChIKey is XJGPCTFEGYRLGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H36N3OP/c1-25-7-8-26(2)37(25)31-13-19-34(20-14-31)41(40,35-21-15-32(16-22-35)38-27(3)9-10-28(38)4)36-23-17-33(18-24-36)39-29(5)11-12-30(39)6/h7-24H,1-6H3.
What are the key properties of 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole?
1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole has a molecular weight of 557.68 g/mol, XLogP of 7.55, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-bis[4-(2,5-dimethylpyrrol-1-yl)phenyl]phosphorylphenyl]-2,5-dimethylpyrrole is sourced from PubChem (CID 134973585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).