C18H34O3 — CID 134973826
(3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxane (PubChem CID 134973826) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is (3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxane.
| Compound Name | (3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxane |
|---|---|
| PubChem CID | 134973826 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | (3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxane |
| SMILES | CC1C(C)[C@H](C)C(C)O[C@H]1OC1C(C)[C@H](C)OC(C)[C@H]1C |
| InChI | InChI=1S/C18H34O3/c1-9-10(2)14(6)20-18(11(9)3)21-17-12(4)15(7)19-16(8)13(17)5/h9-18H,1-8H3/t9?,10-,11?,12+,13?,14?,15?,16-,17?,18-/m0/s1 |
| InChIKey | KCVXNCSEGOSHBJ-CWRXUMIRSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |