C26H23NO4 — CID 134973839
ethyl 4-[2-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethylphenyl]benzoate (PubChem CID 134973839) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl 4-[2-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethylphenyl]benzoate.
| Compound Name | ethyl 4-[2-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethylphenyl]benzoate |
|---|---|
| PubChem CID | 134973839 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | ethyl 4-[2-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethylphenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cc(C)c(C)cc2CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H23NO4/c1-4-31-26(30)19-11-9-18(10-12-19)23-14-17(3)16(2)13-20(23)15-27-24(28)21-7-5-6-8-22(21)25(27)29/h5-14H,4,15H2,1-3H3 |
| InChIKey | DCXQNVXYQAMJQU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|