About methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate
methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate (PubChem CID 134973890) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate.
Analyze methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate?
The IUPAC name of methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate (CID 134973890) is methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate.
What is the SMILES notation for methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate?
The canonical SMILES for methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate is COC(=O)CCC1CC(C)=C(C)C1=O.
What is the InChIKey of methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate?
The InChIKey is QQXGWURFBNCSNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-7-6-9(11(13)8(7)2)4-5-10(12)14-3/h9H,4-6H2,1-3H3.
What are the key properties of methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate?
methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate has a molecular weight of 196.25 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-dimethyl-2-oxocyclopent-3-en-1-yl)propanoate is sourced from PubChem (CID 134973890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).