C21H36O5 — CID 134973910
methyl 2-[(2S,3R,6S)-6-[(E,3S)-3-[(2R,3S,5R)-5-(1-methoxyethyl)-3-methyloxolan-2-yl]but-1-enyl]-3-methyloxan-2-yl]acetate (PubChem CID 134973910) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is methyl 2-[(2S,3R,6S)-6-[(E,3S)-3-[(2R,3S,5R)-5-(1-methoxyethyl)-3-methyloxolan-2-yl]but-1-enyl]-3-methyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,6S)-6-[(E,3S)-3-[(2R,3S,5R)-5-(1-methoxyethyl)-3-methyloxolan-2-yl]but-1-enyl]-3-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 134973910 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | methyl 2-[(2S,3R,6S)-6-[(E,3S)-3-[(2R,3S,5R)-5-(1-methoxyethyl)-3-methyloxolan-2-yl]but-1-enyl]-3-methyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](/C=C/[C@H](C)[C@@H]2O[C@@H](C(C)OC)C[C@@H]2C)CC[C@H]1C |
| InChI | InChI=1S/C21H36O5/c1-13-7-9-17(25-18(13)12-20(22)24-6)10-8-14(2)21-15(3)11-19(26-21)16(4)23-5/h8,10,13-19,21H,7,9,11-12H2,1-6H3/b10-8+/t13-,14+,15+,16?,17+,18+,19-,21+/m1/s1 |
| InChIKey | LUQXXHMRPWQXQM-UXAPZCKGSA-N |
| XLogP | 3.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|