About CID 134974054
CID 134974054 (PubChem CID 134974054) has the molecular formula C21H34BNO4Si
and a molecular weight of 403.40 g/mol.
Molecular Properties
| Compound Name | CID 134974054 |
| PubChem CID | 134974054 |
| Molecular Formula | C21H34BNO4Si |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1C[C@@H]([C@@H]2O[C@H](C)OC[C@H]2O[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H34BNO4Si/c1-15-24-14-18(27-28(5,6)21(2,3)4)20(25-15)17-12-19(22)26-23(17)13-16-10-8-7-9-11-16/h7-11,15,17-20H,12-14H2,1-6H3/t15-,17+,18-,19+,20+/m1/s1 |
| InChIKey | PNFJUPAZBGBOKC-XZEJUNMKSA-N |
| XLogP | 3.84 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134974054 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134974054?
The IUPAC name of CID 134974054 (CID 134974054) is not available.
What is the SMILES notation for CID 134974054?
The canonical SMILES for CID 134974054 is [B][C@@H]1C[C@@H]([C@@H]2O[C@H](C)OC[C@H]2O[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)O1.
What is the InChIKey of CID 134974054?
The InChIKey is PNFJUPAZBGBOKC-XZEJUNMKSA-N. The full InChI is InChI=1S/C21H34BNO4Si/c1-15-24-14-18(27-28(5,6)21(2,3)4)20(25-15)17-12-19(22)26-23(17)13-16-10-8-7-9-11-16/h7-11,15,17-20H,12-14H2,1-6H3/t15-,17+,18-,19+,20+/m1/s1.
What are the key properties of CID 134974054?
CID 134974054 has a molecular weight of 403.40 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134974054 is sourced from PubChem (CID 134974054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).