C25H54O3Si2 — CID 134974170
[(3S,4S,6S)-4,6-dimethyl-2-tri(propan-2-yl)silyloxyoxan-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 134974170) has the molecular formula C25H54O3Si2 and a molecular weight of 458.88 g/mol. Its IUPAC name is [(3S,4S,6S)-4,6-dimethyl-2-tri(propan-2-yl)silyloxyoxan-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3S,4S,6S)-4,6-dimethyl-2-tri(propan-2-yl)silyloxyoxan-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134974170 |
| Molecular Formula | C25H54O3Si2 |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | [(3S,4S,6S)-4,6-dimethyl-2-tri(propan-2-yl)silyloxyoxan-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1O[C@@H](C)C[C@H](C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H54O3Si2/c1-16(2)29(17(3)4,18(5)6)27-24-22(13)15-23(14)26-25(24)28-30(19(7)8,20(9)10)21(11)12/h16-25H,15H2,1-14H3/t22-,23-,24-,25?/m0/s1 |
| InChIKey | DBHXGFATWACFIV-UKXRBIRESA-N |
| XLogP | 8.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|