C70H88F4O2 — CID 134974254
methyl 2,5-bis[(E)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]benzoate (PubChem CID 134974254) has the molecular formula C70H88F4O2 and a molecular weight of 1037.46 g/mol. Its IUPAC name is methyl 2,5-bis[(E)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]benzoate.
| Compound Name | methyl 2,5-bis[(E)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]benzoate |
|---|---|
| PubChem CID | 134974254 |
| Molecular Formula | C70H88F4O2 |
| Molecular Weight | 1037.46 g/mol |
| Exact Mass | 1036.67 |
| IUPAC Name | methyl 2,5-bis[(E)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]benzoate |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(/C(F)=C(\F)c3ccc(/C(F)=C(\F)c4ccc5c(c4)C(CCCCCCCC)(CCCCCCCC)c4ccccc4-5)c(C(=O)OC)c3)cc21 |
| InChI | InChI=1S/C70H88F4O2/c1-6-10-14-18-22-30-44-69(45-31-23-19-15-11-7-2)60-36-28-26-34-54(60)56-41-38-52(49-62(56)69)65(72)64(71)51-40-43-58(59(48-51)68(75)76-5)67(74)66(73)53-39-42-57-55-35-27-29-37-61(55)70(63(57)50-53,46-32-24-20-16-12-8-3)47-33-25-21-17-13-9-4/h26-29,34-43,48-50H,6-25,30-33,44-47H2,1-5H3/b65-64+,67-66+ |
| InChIKey | DSVMDYRPBKXFLD-GNMNMALHSA-N |
| XLogP | 22.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.46 |
| LogP ≤ 5 | 22.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|