C43H68F2Sn — CID 134974318
tributyl-[(Z)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]stannane (PubChem CID 134974318) has the molecular formula C43H68F2Sn and a molecular weight of 741.72 g/mol. Its IUPAC name is tributyl-[(Z)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]stannane.
| Compound Name | tributyl-[(Z)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]stannane |
|---|---|
| PubChem CID | 134974318 |
| Molecular Formula | C43H68F2Sn |
| Molecular Weight | 741.72 g/mol |
| Exact Mass | 742.43 |
| IUPAC Name | tributyl-[(Z)-2-(9,9-dioctylfluoren-2-yl)-1,2-difluoroethenyl]stannane |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(/C(F)=C(\F)[Sn](CCCC)(CCCC)CCCC)cc21 |
| InChI | InChI=1S/C31H41F2.3C4H9.Sn/c1-3-5-7-9-11-15-21-31(22-16-12-10-8-6-4-2)28-18-14-13-17-26(28)27-20-19-25(23-29(27)31)30(33)24-32;3*1-3-4-2;/h13-14,17-20,23H,3-12,15-16,21-22H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | MAUASFSDEVWPQG-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.72 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|