C11H15IO4 — CID 134974351
ethyl (3E)-2-(iodomethyl)-8-oxo-2,5,6,7-tetrahydrooxocine-4-carboxylate (PubChem CID 134974351) has the molecular formula C11H15IO4 and a molecular weight of 338.14 g/mol. Its IUPAC name is ethyl (3E)-2-(iodomethyl)-8-oxo-2,5,6,7-tetrahydrooxocine-4-carboxylate.
| Compound Name | ethyl (3E)-2-(iodomethyl)-8-oxo-2,5,6,7-tetrahydrooxocine-4-carboxylate |
|---|---|
| PubChem CID | 134974351 |
| Molecular Formula | C11H15IO4 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | ethyl (3E)-2-(iodomethyl)-8-oxo-2,5,6,7-tetrahydrooxocine-4-carboxylate |
| SMILES | CCOC(=O)/C1=C/C(CI)OC(=O)CCC1 |
| InChI | InChI=1S/C11H15IO4/c1-2-15-11(14)8-4-3-5-10(13)16-9(6-8)7-12/h6,9H,2-5,7H2,1H3/b8-6+ |
| InChIKey | AIGYAPGEZLOANQ-SOFGYWHQSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|