C19H30O3 — CID 134974361
6-[(2E,7Z)-5-methoxy-4,6-dimethyldeca-2,7,9-trien-2-yl]-5-methyloxan-2-one (PubChem CID 134974361) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 6-[(2E,7Z)-5-methoxy-4,6-dimethyldeca-2,7,9-trien-2-yl]-5-methyloxan-2-one.
| Compound Name | 6-[(2E,7Z)-5-methoxy-4,6-dimethyldeca-2,7,9-trien-2-yl]-5-methyloxan-2-one |
|---|---|
| PubChem CID | 134974361 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 6-[(2E,7Z)-5-methoxy-4,6-dimethyldeca-2,7,9-trien-2-yl]-5-methyloxan-2-one |
| SMILES | C=C/C=C\C(C)C(OC)C(C)/C=C(\C)C1OC(=O)CCC1C |
| InChI | InChI=1S/C19H30O3/c1-7-8-9-13(2)18(21-6)15(4)12-16(5)19-14(3)10-11-17(20)22-19/h7-9,12-15,18-19H,1,10-11H2,2-6H3/b9-8-,16-12+ |
| InChIKey | CNDOOVXWGUBKQE-JHKMCZGTSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|