C21H34O5 — CID 134974364
ethyl (2E,4S,5R,6S,7E)-5-methoxy-2,4,6-trimethyl-8-[(2S,3R)-3-methyl-6-oxooxan-2-yl]nona-2,7-dienoate (PubChem CID 134974364) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethyl (2E,4S,5R,6S,7E)-5-methoxy-2,4,6-trimethyl-8-[(2S,3R)-3-methyl-6-oxooxan-2-yl]nona-2,7-dienoate.
| Compound Name | ethyl (2E,4S,5R,6S,7E)-5-methoxy-2,4,6-trimethyl-8-[(2S,3R)-3-methyl-6-oxooxan-2-yl]nona-2,7-dienoate |
|---|---|
| PubChem CID | 134974364 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | ethyl (2E,4S,5R,6S,7E)-5-methoxy-2,4,6-trimethyl-8-[(2S,3R)-3-methyl-6-oxooxan-2-yl]nona-2,7-dienoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C)[C@H](OC)[C@@H](C)/C=C(\C)[C@H]1OC(=O)CC[C@H]1C |
| InChI | InChI=1S/C21H34O5/c1-8-25-21(23)17(6)12-15(4)19(24-7)14(3)11-16(5)20-13(2)9-10-18(22)26-20/h11-15,19-20H,8-10H2,1-7H3/b16-11+,17-12+/t13-,14+,15+,19-,20+/m1/s1 |
| InChIKey | YGNCBIWKGPWWMS-KVQISLLDSA-N |
| XLogP | 4.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|