C11H14NO2S+ — CID 134974393
[(1R,2R)-1-carboxy-2-phenylsulfanylcyclobutyl]azanium (PubChem CID 134974393) has the molecular formula C11H14NO2S+ and a molecular weight of 224.31 g/mol. Its IUPAC name is [(1R,2R)-1-carboxy-2-phenylsulfanylcyclobutyl]azanium.
| Compound Name | [(1R,2R)-1-carboxy-2-phenylsulfanylcyclobutyl]azanium |
|---|---|
| PubChem CID | 134974393 |
| Molecular Formula | C11H14NO2S+ |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | [(1R,2R)-1-carboxy-2-phenylsulfanylcyclobutyl]azanium |
| SMILES | [NH3+][C@@]1(C(=O)O)CC[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C11H13NO2S/c12-11(10(13)14)7-6-9(11)15-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)/p+1/t9-,11+/m1/s1 |
| InChIKey | YGGZHVJXUCIPST-KOLCDFICSA-O |
| XLogP | 1.01 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |