C22H35IO3Si — CID 134974569
tert-butyl-[(Z,5S)-1-[(5R)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]dec-6-en-1,3-diyn-5-yl]oxy-dimethylsilane (PubChem CID 134974569) has the molecular formula C22H35IO3Si and a molecular weight of 502.51 g/mol. Its IUPAC name is tert-butyl-[(Z,5S)-1-[(5R)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]dec-6-en-1,3-diyn-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,5S)-1-[(5R)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]dec-6-en-1,3-diyn-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134974569 |
| Molecular Formula | C22H35IO3Si |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | tert-butyl-[(Z,5S)-1-[(5R)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]dec-6-en-1,3-diyn-5-yl]oxy-dimethylsilane |
| SMILES | CCC/C=C\[C@@H](C#CC#CC1OC(C)(C)O[C@H]1CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35IO3Si/c1-9-10-11-14-18(26-27(7,8)21(2,3)4)15-12-13-16-19-20(17-23)25-22(5,6)24-19/h11,14,18-20H,9-10,17H2,1-8H3/b14-11-/t18-,19?,20-/m0/s1 |
| InChIKey | OQXWUMKYILOHEF-VWJUMELCSA-N |
| XLogP | 5.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|