C21H37ClHgO4Si — CID 134974676
[(1R,2S,4aS,5R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxycarbonyl-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl]-chloromercury (PubChem CID 134974676) has the molecular formula C21H37ClHgO4Si and a molecular weight of 617.65 g/mol. Its IUPAC name is [(1R,2S,4aS,5R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxycarbonyl-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl]-chloromercury.
| Compound Name | [(1R,2S,4aS,5R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxycarbonyl-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl]-chloromercury |
|---|---|
| PubChem CID | 134974676 |
| Molecular Formula | C21H37ClHgO4Si |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | [(1R,2S,4aS,5R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxycarbonyl-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl]-chloromercury |
| SMILES | COC(=O)[C@H]1C(=O)CCC2[C@]1(C)CC[C@H]([Hg]Cl)[C@@]2(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H37O4Si.ClH.Hg/c1-19(2,3)26(7,8)25-14-20(4)12-9-13-21(5)16(20)11-10-15(22)17(21)18(23)24-6;;/h12,16-17H,9-11,13-14H2,1-8H3;1H;/q;;+1/p-1/t16?,17-,20+,21+;;/m1../s1 |
| InChIKey | DDOHKELVBUKRGU-KVOGJOFFSA-M |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|