C21H37NO4 — CID 134974724
tert-butyl N-[(1S)-1-(2-butyl-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]furan-2-yl)-2-hydroxyethyl]carbamate (PubChem CID 134974724) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(2-butyl-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]furan-2-yl)-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(2-butyl-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]furan-2-yl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 134974724 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | tert-butyl N-[(1S)-1-(2-butyl-5,6,7,8,9,9a-hexahydro-4H-cycloocta[b]furan-2-yl)-2-hydroxyethyl]carbamate |
| SMILES | CCCCC1([C@H](CO)NC(=O)OC(C)(C)C)C=C2CCCCCCC2O1 |
| InChI | InChI=1S/C21H37NO4/c1-5-6-13-21(18(15-23)22-19(24)26-20(2,3)4)14-16-11-9-7-8-10-12-17(16)25-21/h14,17-18,23H,5-13,15H2,1-4H3,(H,22,24)/t17?,18-,21?/m0/s1 |
| InChIKey | GIEOWLZVPZCIBD-WBTXTPOCSA-N |
| XLogP | 4.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|