C23H32O13 — CID 134974786
[(2R,3S,4R)-4-acetyloxy-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134974786) has the molecular formula C23H32O13 and a molecular weight of 516.50 g/mol. Its IUPAC name is [(2R,3S,4R)-4-acetyloxy-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R)-4-acetyloxy-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134974786 |
| Molecular Formula | C23H32O13 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | [(2R,3S,4R)-4-acetyloxy-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](OC(C)=O)C=CO[C@@H]2COC(C)=O)[C@H](C)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H32O13/c1-11-20(33-15(5)27)22(34-16(6)28)19(10-31-13(3)25)35-23(11)36-21-17(32-14(4)26)7-8-29-18(21)9-30-12(2)24/h7-8,11,17-23H,9-10H2,1-6H3/t11-,17-,18-,19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | YDHVTAAJLBFSBT-LYZRDDMTSA-N |
| XLogP | 0.57 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|