C33H69LiO4Si3 — CID 134974832
lithium tri(propan-2-yl)-[[(2R,3R,4R)-3-tri(propan-2-yl)silyloxy-2-[tri(propan-2-yl)silyloxymethyl]-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]silane (PubChem CID 134974832) has the molecular formula C33H69LiO4Si3 and a molecular weight of 621.11 g/mol. Its IUPAC name is lithium tri(propan-2-yl)-[[(2R,3R,4R)-3-tri(propan-2-yl)silyloxy-2-[tri(propan-2-yl)silyloxymethyl]-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]silane.
| Compound Name | lithium tri(propan-2-yl)-[[(2R,3R,4R)-3-tri(propan-2-yl)silyloxy-2-[tri(propan-2-yl)silyloxymethyl]-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]silane |
|---|---|
| PubChem CID | 134974832 |
| Molecular Formula | C33H69LiO4Si3 |
| Molecular Weight | 621.11 g/mol |
| Exact Mass | 620.47 |
| IUPAC Name | lithium tri(propan-2-yl)-[[(2R,3R,4R)-3-tri(propan-2-yl)silyloxy-2-[tri(propan-2-yl)silyloxymethyl]-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]silane |
| SMILES | CC(C)[Si](OC[C@H]1O[C-]=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C.[Li+] |
| InChI | InChI=1S/C33H69O4Si3.Li/c1-22(2)38(23(3)4,24(5)6)35-21-32-33(37-40(28(13)14,29(15)16)30(17)18)31(19-20-34-32)36-39(25(7)8,26(9)10)27(11)12;/h19,22-33H,21H2,1-18H3;/q-1;+1/t31-,32-,33+;/m1./s1 |
| InChIKey | UYJDOJHEQOFECT-BAKKYWBDSA-N |
| XLogP | 8.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.11 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|