C15H24O4 — CID 134974869
ethyl (3aS,5R,6aS)-5-butoxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate (PubChem CID 134974869) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is ethyl (3aS,5R,6aS)-5-butoxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate.
| Compound Name | ethyl (3aS,5R,6aS)-5-butoxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 134974869 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | ethyl (3aS,5R,6aS)-5-butoxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
| SMILES | CCCCO[C@@H]1C[C@H]2CC(=O)C(C(=O)OCC)[C@H]2C1 |
| InChI | InChI=1S/C15H24O4/c1-3-5-6-19-11-7-10-8-13(16)14(12(10)9-11)15(17)18-4-2/h10-12,14H,3-9H2,1-2H3/t10-,11+,12-,14?/m0/s1 |
| InChIKey | GIWBZMNHCOXYSW-JACPFSORSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|