About 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate
2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate (PubChem CID 134974912) has the molecular formula C17H36O5Si
and a molecular weight of 348.56 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate |
| PubChem CID | 134974912 |
| Molecular Formula | C17H36O5Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate |
| SMILES | COC(CCCCCCC(O)CC(=O)OCC[Si](C)(C)C)OC |
| InChI | InChI=1S/C17H36O5Si/c1-20-17(21-2)11-9-7-6-8-10-15(18)14-16(19)22-12-13-23(3,4)5/h15,17-18H,6-14H2,1-5H3 |
| InChIKey | CISLYSZGWYDPCG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate?
The IUPAC name of 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate (CID 134974912) is 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate.
What is the SMILES notation for 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate?
The canonical SMILES for 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate is COC(CCCCCCC(O)CC(=O)OCC[Si](C)(C)C)OC.
What is the InChIKey of 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate?
The InChIKey is CISLYSZGWYDPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O5Si/c1-20-17(21-2)11-9-7-6-8-10-15(18)14-16(19)22-12-13-23(3,4)5/h15,17-18H,6-14H2,1-5H3.
What are the key properties of 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate?
2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate has a molecular weight of 348.56 g/mol, XLogP of 3.58, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 3-hydroxy-10,10-dimethoxydecanoate is sourced from PubChem (CID 134974912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).