C38H60O5Si2 — CID 134974935
ethyl 3-[(2R)-2-butyl-2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-3,4-dihydropyran-6-yl]propanoate (PubChem CID 134974935) has the molecular formula C38H60O5Si2 and a molecular weight of 653.07 g/mol. Its IUPAC name is ethyl 3-[(2R)-2-butyl-2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-3,4-dihydropyran-6-yl]propanoate.
| Compound Name | ethyl 3-[(2R)-2-butyl-2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-3,4-dihydropyran-6-yl]propanoate |
|---|---|
| PubChem CID | 134974935 |
| Molecular Formula | C38H60O5Si2 |
| Molecular Weight | 653.07 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | ethyl 3-[(2R)-2-butyl-2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-triethylsilyloxyethyl]-3,4-dihydropyran-6-yl]propanoate |
| SMILES | CCCC[C@]1([C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[Si](CC)(CC)CC)CCC=C(CCC(=O)OCC)O1 |
| InChI | InChI=1S/C38H60O5Si2/c1-9-14-29-38(30-21-22-32(42-38)27-28-36(39)40-10-2)35(43-44(11-3,12-4)13-5)31-41-45(37(6,7)8,33-23-17-15-18-24-33)34-25-19-16-20-26-34/h15-20,22-26,35H,9-14,21,27-31H2,1-8H3/t35-,38+/m0/s1 |
| InChIKey | YUOWWPZTFKDHMV-ZGAWMTGXSA-N |
| XLogP | 8.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.07 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|