C15H21N11 — CID 134974949
1,4,5,6,9,12,13,14,19,20,21-undecazapentacyclo[7.7.7.13,6.112,15.118,21]hexacosa-3(26),4,13,15(25),18(24),19-hexaene (PubChem CID 134974949) has the molecular formula C15H21N11 and a molecular weight of 355.41 g/mol. Its IUPAC name is 1,4,5,6,9,12,13,14,19,20,21-undecazapentacyclo[7.7.7.13,6.112,15.118,21]hexacosa-3(26),4,13,15(25),18(24),19-hexaene.
| Compound Name | 1,4,5,6,9,12,13,14,19,20,21-undecazapentacyclo[7.7.7.13,6.112,15.118,21]hexacosa-3(26),4,13,15(25),18(24),19-hexaene |
|---|---|
| PubChem CID | 134974949 |
| Molecular Formula | C15H21N11 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1,4,5,6,9,12,13,14,19,20,21-undecazapentacyclo[7.7.7.13,6.112,15.118,21]hexacosa-3(26),4,13,15(25),18(24),19-hexaene |
| SMILES | c1c2nnn1CCN1CCn3cc(nn3)CN(C2)Cc2cn(nn2)CC1 |
| InChI | InChI=1S/C15H21N11/c1-4-24-10-13(16-19-24)7-23-8-14-11-25(20-17-14)5-2-22(1)3-6-26-12-15(9-23)18-21-26/h10-12H,1-9H2 |
| InChIKey | MJEVUMMECKDYDM-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 98.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |