C17H29O4P — CID 134975126
5-tert-butyl-2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1-benzofuran (PubChem CID 134975126) has the molecular formula C17H29O4P and a molecular weight of 328.39 g/mol. Its IUPAC name is 5-tert-butyl-2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1-benzofuran.
| Compound Name | 5-tert-butyl-2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 134975126 |
| Molecular Formula | C17H29O4P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 5-tert-butyl-2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1-benzofuran |
| SMILES | CCOP(=O)(Cc1cc2c(o1)CCC(C(C)(C)C)C2)OCC |
| InChI | InChI=1S/C17H29O4P/c1-6-19-22(18,20-7-2)12-15-11-13-10-14(17(3,4)5)8-9-16(13)21-15/h11,14H,6-10,12H2,1-5H3 |
| InChIKey | KRESDQKNUWFBIN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|